C14H19F2N3O2 — CID 122097384
1-(2,5-difluorophenyl)-2-[(3-methoxyoxan-4-yl)methyl]guanidine (PubChem CID 122097384) has the molecular formula C14H19F2N3O2 and a molecular weight of 299.32 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-[(3-methoxyoxan-4-yl)methyl]guanidine.
| Compound Name | 1-(2,5-difluorophenyl)-2-[(3-methoxyoxan-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 122097384 |
| Molecular Formula | C14H19F2N3O2 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-[(3-methoxyoxan-4-yl)methyl]guanidine |
| SMILES | COC1COCCC1C/N=C(\N)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C14H19F2N3O2/c1-20-13-8-21-5-4-9(13)7-18-14(17)19-12-6-10(15)2-3-11(12)16/h2-3,6,9,13H,4-5,7-8H2,1H3,(H3,17,18,19) |
| InChIKey | VHOKKUXGDWWNNT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|