C19H19F2NO5S — CID 159692994
N-(2,5-difluorophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzamide (PubChem CID 159692994) has the molecular formula C19H19F2NO5S and a molecular weight of 411.43 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzamide.
| Compound Name | N-(2,5-difluorophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzamide |
|---|---|
| PubChem CID | 159692994 |
| Molecular Formula | C19H19F2NO5S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)C[C@H]2CCOC2)cc1C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C19H19F2NO5S/c1-26-18-5-3-14(28(24,25)11-12-6-7-27-10-12)9-15(18)19(23)22-17-8-13(20)2-4-16(17)21/h2-5,8-9,12H,6-7,10-11H2,1H3,(H,22,23)/t12-/m0/s1 |
| InChIKey | ZHUVTYVNYNUHOM-LBPRGKRZSA-N |
| XLogP | 3.04 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |