C20H22N2O5S2 — CID 159506018
N-(3-cyanophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzamide;sulfane (PubChem CID 159506018) has the molecular formula C20H22N2O5S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzamide;sulfane.
| Compound Name | N-(3-cyanophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzamide;sulfane |
|---|---|
| PubChem CID | 159506018 |
| Molecular Formula | C20H22N2O5S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-(3-cyanophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzamide;sulfane |
| SMILES | COc1ccc(S(=O)(=O)C[C@H]2CCOC2)cc1C(=O)Nc1cccc(C#N)c1.S |
| InChI | InChI=1S/C20H20N2O5S.H2S/c1-26-19-6-5-17(28(24,25)13-15-7-8-27-12-15)10-18(19)20(23)22-16-4-2-3-14(9-16)11-21;/h2-6,9-10,15H,7-8,12-13H2,1H3,(H,22,23);1H2/t15-;/m0./s1 |
| InChIKey | LZZMXMQJDBDONG-RSAXXLAASA-N |
| XLogP | 2.74 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |