C18H19ClN2O5S — CID 146256158
N-(3-chlorophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]sulfamoyl]benzamide (PubChem CID 146256158) has the molecular formula C18H19ClN2O5S and a molecular weight of 410.88 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]sulfamoyl]benzamide.
| Compound Name | N-(3-chlorophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 146256158 |
| Molecular Formula | C18H19ClN2O5S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | N-(3-chlorophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]sulfamoyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@H]2CCOC2)cc1C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H19ClN2O5S/c1-25-17-6-5-15(27(23,24)21-14-7-8-26-11-14)10-16(17)18(22)20-13-4-2-3-12(19)9-13/h2-6,9-10,14,21H,7-8,11H2,1H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | YZVWPAGITVJSEC-AWEZNQCLSA-N |
| XLogP | 2.67 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |