C18H17ClF2N2O5S — CID 146237242
N-(2-chloro-4,6-difluorophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]sulfamoyl]benzamide (PubChem CID 146237242) has the molecular formula C18H17ClF2N2O5S and a molecular weight of 446.86 g/mol. Its IUPAC name is N-(2-chloro-4,6-difluorophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]sulfamoyl]benzamide.
| Compound Name | N-(2-chloro-4,6-difluorophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 146237242 |
| Molecular Formula | C18H17ClF2N2O5S |
| Molecular Weight | 446.86 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | N-(2-chloro-4,6-difluorophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]sulfamoyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@H]2CCOC2)cc1C(=O)Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C18H17ClF2N2O5S/c1-27-16-3-2-12(29(25,26)23-11-4-5-28-9-11)8-13(16)18(24)22-17-14(19)6-10(20)7-15(17)21/h2-3,6-8,11,23H,4-5,9H2,1H3,(H,22,24)/t11-/m0/s1 |
| InChIKey | RLQDUUYYTXWELB-NSHDSACASA-N |
| XLogP | 2.95 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.86 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |