C20H21F3N2O5S — CID 146237340
N-[3-(difluoromethyl)-4-fluorophenyl]-2-methoxy-5-[[(3S)-oxan-3-yl]sulfamoyl]benzamide (PubChem CID 146237340) has the molecular formula C20H21F3N2O5S and a molecular weight of 458.46 g/mol. Its IUPAC name is N-[3-(difluoromethyl)-4-fluorophenyl]-2-methoxy-5-[[(3S)-oxan-3-yl]sulfamoyl]benzamide.
| Compound Name | N-[3-(difluoromethyl)-4-fluorophenyl]-2-methoxy-5-[[(3S)-oxan-3-yl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 146237340 |
| Molecular Formula | C20H21F3N2O5S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | N-[3-(difluoromethyl)-4-fluorophenyl]-2-methoxy-5-[[(3S)-oxan-3-yl]sulfamoyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@H]2CCCOC2)cc1C(=O)Nc1ccc(F)c(C(F)F)c1 |
| InChI | InChI=1S/C20H21F3N2O5S/c1-29-18-7-5-14(31(27,28)25-13-3-2-8-30-11-13)10-16(18)20(26)24-12-4-6-17(21)15(9-12)19(22)23/h4-7,9-10,13,19,25H,2-3,8,11H2,1H3,(H,24,26)/t13-/m0/s1 |
| InChIKey | QJIUPZYAEYHJDW-ZDUSSCGKSA-N |
| XLogP | 3.48 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |