C17H19FN4O5S — CID 146237320
N-(5-fluoro-4-methylpyrimidin-2-yl)-2-methoxy-5-(oxolan-3-ylsulfamoyl)benzamide (PubChem CID 146237320) has the molecular formula C17H19FN4O5S and a molecular weight of 410.43 g/mol. Its IUPAC name is N-(5-fluoro-4-methylpyrimidin-2-yl)-2-methoxy-5-(oxolan-3-ylsulfamoyl)benzamide.
| Compound Name | N-(5-fluoro-4-methylpyrimidin-2-yl)-2-methoxy-5-(oxolan-3-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 146237320 |
| Molecular Formula | C17H19FN4O5S |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-(5-fluoro-4-methylpyrimidin-2-yl)-2-methoxy-5-(oxolan-3-ylsulfamoyl)benzamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CCOC2)cc1C(=O)Nc1ncc(F)c(C)n1 |
| InChI | InChI=1S/C17H19FN4O5S/c1-10-14(18)8-19-17(20-10)21-16(23)13-7-12(3-4-15(13)26-2)28(24,25)22-11-5-6-27-9-11/h3-4,7-8,11,22H,5-6,9H2,1-2H3,(H,19,20,21,23) |
| InChIKey | NYDNLRRQGGDBIB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |