C18H17F3N2O5S — CID 146559528
2-methoxy-5-(oxolan-3-ylsulfamoyl)-N-(2,4,5-trifluorophenyl)benzamide (PubChem CID 146559528) has the molecular formula C18H17F3N2O5S and a molecular weight of 430.40 g/mol. Its IUPAC name is 2-methoxy-5-(oxolan-3-ylsulfamoyl)-N-(2,4,5-trifluorophenyl)benzamide.
| Compound Name | 2-methoxy-5-(oxolan-3-ylsulfamoyl)-N-(2,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 146559528 |
| Molecular Formula | C18H17F3N2O5S |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 2-methoxy-5-(oxolan-3-ylsulfamoyl)-N-(2,4,5-trifluorophenyl)benzamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CCOC2)cc1C(=O)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H17F3N2O5S/c1-27-17-3-2-11(29(25,26)23-10-4-5-28-9-10)6-12(17)18(24)22-16-8-14(20)13(19)7-15(16)21/h2-3,6-8,10,23H,4-5,9H2,1H3,(H,22,24) |
| InChIKey | URCYZFJQYFMBFS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|