C18H18Cl2N2O5S — CID 146237316
N-(2,5-dichlorophenyl)-2-methoxy-5-(oxolan-3-ylsulfamoyl)benzamide (PubChem CID 146237316) has the molecular formula C18H18Cl2N2O5S and a molecular weight of 445.32 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-methoxy-5-(oxolan-3-ylsulfamoyl)benzamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-methoxy-5-(oxolan-3-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 146237316 |
| Molecular Formula | C18H18Cl2N2O5S |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-methoxy-5-(oxolan-3-ylsulfamoyl)benzamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CCOC2)cc1C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O5S/c1-26-17-5-3-13(28(24,25)22-12-6-7-27-10-12)9-14(17)18(23)21-16-8-11(19)2-4-15(16)20/h2-5,8-9,12,22H,6-7,10H2,1H3,(H,21,23) |
| InChIKey | HHTXREKXWNBOPW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |