C17H18ClN3O5S — CID 146559576
N-(3-chloro-2-pyridinyl)-2-methoxy-5-(oxolan-3-ylsulfamoyl)benzamide (PubChem CID 146559576) has the molecular formula C17H18ClN3O5S and a molecular weight of 411.87 g/mol. Its IUPAC name is N-(3-chloro-2-pyridinyl)-2-methoxy-5-(oxolan-3-ylsulfamoyl)benzamide.
| Compound Name | N-(3-chloro-2-pyridinyl)-2-methoxy-5-(oxolan-3-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 146559576 |
| Molecular Formula | C17H18ClN3O5S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | N-(3-chloro-2-pyridinyl)-2-methoxy-5-(oxolan-3-ylsulfamoyl)benzamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CCOC2)cc1C(=O)Nc1ncccc1Cl |
| InChI | InChI=1S/C17H18ClN3O5S/c1-25-15-5-4-12(27(23,24)21-11-6-8-26-10-11)9-13(15)17(22)20-16-14(18)3-2-7-19-16/h2-5,7,9,11,21H,6,8,10H2,1H3,(H,19,20,22) |
| InChIKey | WCKVWDZLXHUQQJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |