C19H18F3NO5S — CID 161284309
2-methoxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]-N-(2,4,5-trifluorophenyl)benzamide (PubChem CID 161284309) has the molecular formula C19H18F3NO5S and a molecular weight of 429.42 g/mol. Its IUPAC name is 2-methoxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]-N-(2,4,5-trifluorophenyl)benzamide.
| Compound Name | 2-methoxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]-N-(2,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 161284309 |
| Molecular Formula | C19H18F3NO5S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 2-methoxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]-N-(2,4,5-trifluorophenyl)benzamide |
| SMILES | COc1ccc(S(=O)(=O)C[C@H]2CCOC2)cc1C(=O)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H18F3NO5S/c1-27-18-3-2-12(29(25,26)10-11-4-5-28-9-11)6-13(18)19(24)23-17-8-15(21)14(20)7-16(17)22/h2-3,6-8,11H,4-5,9-10H2,1H3,(H,23,24)/t11-/m0/s1 |
| InChIKey | QOKUCWFXLDLXCU-NSHDSACASA-N |
| XLogP | 3.17 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|