C13H16O6S — CID 161200499
methyl 2-hydroxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzoate (PubChem CID 161200499) has the molecular formula C13H16O6S and a molecular weight of 300.33 g/mol. Its IUPAC name is methyl 2-hydroxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzoate.
| Compound Name | methyl 2-hydroxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzoate |
|---|---|
| PubChem CID | 161200499 |
| Molecular Formula | C13H16O6S |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | methyl 2-hydroxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)C[C@H]2CCOC2)ccc1O |
| InChI | InChI=1S/C13H16O6S/c1-18-13(15)11-6-10(2-3-12(11)14)20(16,17)8-9-4-5-19-7-9/h2-3,6,9,14H,4-5,7-8H2,1H3/t9-/m0/s1 |
| InChIKey | GLGWUZITYHCCKI-VIFPVBQESA-N |
| XLogP | 0.99 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |