C19H20ClF2NO5S2 — CID 159296553
N-(5-chloro-2,4-difluorophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzamide;sulfane (PubChem CID 159296553) has the molecular formula C19H20ClF2NO5S2 and a molecular weight of 479.95 g/mol. Its IUPAC name is N-(5-chloro-2,4-difluorophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzamide;sulfane.
| Compound Name | N-(5-chloro-2,4-difluorophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzamide;sulfane |
|---|---|
| PubChem CID | 159296553 |
| Molecular Formula | C19H20ClF2NO5S2 |
| Molecular Weight | 479.95 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | N-(5-chloro-2,4-difluorophenyl)-2-methoxy-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzamide;sulfane |
| SMILES | COc1ccc(S(=O)(=O)C[C@H]2CCOC2)cc1C(=O)Nc1cc(Cl)c(F)cc1F.S |
| InChI | InChI=1S/C19H18ClF2NO5S.H2S/c1-27-18-3-2-12(29(25,26)10-11-4-5-28-9-11)6-13(18)19(24)23-17-7-14(20)15(21)8-16(17)22;/h2-3,6-8,11H,4-5,9-10H2,1H3,(H,23,24);1H2/t11-;/m0./s1 |
| InChIKey | LAUIXHCZRMNGNO-MERQFXBCSA-N |
| XLogP | 3.80 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.95 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|