C20H25NO5S2 — CID 158668141
2-methoxy-N-(4-methylphenyl)-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzamide;sulfane (PubChem CID 158668141) has the molecular formula C20H25NO5S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-methoxy-N-(4-methylphenyl)-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzamide;sulfane.
| Compound Name | 2-methoxy-N-(4-methylphenyl)-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzamide;sulfane |
|---|---|
| PubChem CID | 158668141 |
| Molecular Formula | C20H25NO5S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-methoxy-N-(4-methylphenyl)-5-[[(3S)-oxolan-3-yl]methylsulfonyl]benzamide;sulfane |
| SMILES | COc1ccc(S(=O)(=O)C[C@H]2CCOC2)cc1C(=O)Nc1ccc(C)cc1.S |
| InChI | InChI=1S/C20H23NO5S.H2S/c1-14-3-5-16(6-4-14)21-20(22)18-11-17(7-8-19(18)25-2)27(23,24)13-15-9-10-26-12-15;/h3-8,11,15H,9-10,12-13H2,1-2H3,(H,21,22);1H2/t15-;/m0./s1 |
| InChIKey | IDPQKNMTNFMCSZ-RSAXXLAASA-N |
| XLogP | 3.18 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |