C14H17ClO6S — CID 135352785
methyl 5-chlorosulfonyl-2-(oxan-4-ylmethoxy)benzoate (PubChem CID 135352785) has the molecular formula C14H17ClO6S and a molecular weight of 348.80 g/mol. Its IUPAC name is methyl 5-chlorosulfonyl-2-(oxan-4-ylmethoxy)benzoate.
| Compound Name | methyl 5-chlorosulfonyl-2-(oxan-4-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 135352785 |
| Molecular Formula | C14H17ClO6S |
| Molecular Weight | 348.80 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | methyl 5-chlorosulfonyl-2-(oxan-4-ylmethoxy)benzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)Cl)ccc1OCC1CCOCC1 |
| InChI | InChI=1S/C14H17ClO6S/c1-19-14(16)12-8-11(22(15,17)18)2-3-13(12)21-9-10-4-6-20-7-5-10/h2-3,8,10H,4-7,9H2,1H3 |
| InChIKey | LTLOMBIWRZBTHX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.80 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |