C24H28INO6S — CID 155021883
methyl 5-[(6-iodo-4-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-(oxan-4-ylmethoxy)benzoate (PubChem CID 155021883) has the molecular formula C24H28INO6S and a molecular weight of 585.46 g/mol. Its IUPAC name is methyl 5-[(6-iodo-4-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-(oxan-4-ylmethoxy)benzoate.
| Compound Name | methyl 5-[(6-iodo-4-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-(oxan-4-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 155021883 |
| Molecular Formula | C24H28INO6S |
| Molecular Weight | 585.46 g/mol |
| Exact Mass | 585.07 |
| IUPAC Name | methyl 5-[(6-iodo-4-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-(oxan-4-ylmethoxy)benzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)N2CCC(C)c3cc(I)ccc32)ccc1OCC1CCOCC1 |
| InChI | InChI=1S/C24H28INO6S/c1-16-7-10-26(22-5-3-18(25)13-20(16)22)33(28,29)19-4-6-23(21(14-19)24(27)30-2)32-15-17-8-11-31-12-9-17/h3-6,13-14,16-17H,7-12,15H2,1-2H3 |
| InChIKey | AGGBVEYYSUEYSV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|