C24H28INO6S — CID 155011607
5-[(2-ethyl-6-iodo-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-(oxan-4-ylmethoxy)benzoic acid (PubChem CID 155011607) has the molecular formula C24H28INO6S and a molecular weight of 585.46 g/mol. Its IUPAC name is 5-[(2-ethyl-6-iodo-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-(oxan-4-ylmethoxy)benzoic acid.
| Compound Name | 5-[(2-ethyl-6-iodo-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-(oxan-4-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 155011607 |
| Molecular Formula | C24H28INO6S |
| Molecular Weight | 585.46 g/mol |
| Exact Mass | 585.07 |
| IUPAC Name | 5-[(2-ethyl-6-iodo-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-(oxan-4-ylmethoxy)benzoic acid |
| SMILES | CCC1CCc2cc(I)ccc2N1S(=O)(=O)c1ccc(OCC2CCOCC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C24H28INO6S/c1-2-19-5-3-17-13-18(25)4-7-22(17)26(19)33(29,30)20-6-8-23(21(14-20)24(27)28)32-15-16-9-11-31-12-10-16/h4,6-8,13-14,16,19H,2-3,5,9-12,15H2,1H3,(H,27,28) |
| InChIKey | QFWCXAZGWPTGLI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|