C20H22INO6S — CID 135308317
5-[(4-iodo-2-methylphenyl)sulfamoyl]-2-(oxan-4-ylmethoxy)benzoic acid (PubChem CID 135308317) has the molecular formula C20H22INO6S and a molecular weight of 531.37 g/mol. Its IUPAC name is 5-[(4-iodo-2-methylphenyl)sulfamoyl]-2-(oxan-4-ylmethoxy)benzoic acid.
| Compound Name | 5-[(4-iodo-2-methylphenyl)sulfamoyl]-2-(oxan-4-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 135308317 |
| Molecular Formula | C20H22INO6S |
| Molecular Weight | 531.37 g/mol |
| Exact Mass | 531.02 |
| IUPAC Name | 5-[(4-iodo-2-methylphenyl)sulfamoyl]-2-(oxan-4-ylmethoxy)benzoic acid |
| SMILES | Cc1cc(I)ccc1NS(=O)(=O)c1ccc(OCC2CCOCC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H22INO6S/c1-13-10-15(21)2-4-18(13)22-29(25,26)16-3-5-19(17(11-16)20(23)24)28-12-14-6-8-27-9-7-14/h2-5,10-11,14,22H,6-9,12H2,1H3,(H,23,24) |
| InChIKey | VUVKTMBPYYTWEE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|