C14H16INO5 — CID 82991129
5-iodo-2-[2-(oxan-4-ylamino)-2-oxoethoxy]benzoic acid (PubChem CID 82991129) has the molecular formula C14H16INO5 and a molecular weight of 405.19 g/mol. Its IUPAC name is 5-iodo-2-[2-(oxan-4-ylamino)-2-oxoethoxy]benzoic acid.
| Compound Name | 5-iodo-2-[2-(oxan-4-ylamino)-2-oxoethoxy]benzoic acid |
|---|---|
| PubChem CID | 82991129 |
| Molecular Formula | C14H16INO5 |
| Molecular Weight | 405.19 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 5-iodo-2-[2-(oxan-4-ylamino)-2-oxoethoxy]benzoic acid |
| SMILES | O=C(COc1ccc(I)cc1C(=O)O)NC1CCOCC1 |
| InChI | InChI=1S/C14H16INO5/c15-9-1-2-12(11(7-9)14(18)19)21-8-13(17)16-10-3-5-20-6-4-10/h1-2,7,10H,3-6,8H2,(H,16,17)(H,18,19) |
| InChIKey | ABWYSOULSWTRCO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|