C15H12INO4 — CID 45418047
2-(2-anilino-2-oxoethoxy)-5-iodobenzoic acid (PubChem CID 45418047) has the molecular formula C15H12INO4 and a molecular weight of 397.17 g/mol. Its IUPAC name is 2-(2-anilino-2-oxoethoxy)-5-iodobenzoic acid.
| Compound Name | 2-(2-anilino-2-oxoethoxy)-5-iodobenzoic acid |
|---|---|
| PubChem CID | 45418047 |
| Molecular Formula | C15H12INO4 |
| Molecular Weight | 397.17 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | 2-(2-anilino-2-oxoethoxy)-5-iodobenzoic acid |
| SMILES | O=C(COc1ccc(I)cc1C(=O)O)Nc1ccccc1 |
| InChI | InChI=1S/C15H12INO4/c16-10-6-7-13(12(8-10)15(19)20)21-9-14(18)17-11-4-2-1-3-5-11/h1-8H,9H2,(H,17,18)(H,19,20) |
| InChIKey | RGAXDYACZVCZHX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.17 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|