C13H17F2N3O2 — CID 122082845
1-(2,5-difluorophenyl)-2-[[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]methyl]guanidine (PubChem CID 122082845) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-[[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]methyl]guanidine.
| Compound Name | 1-(2,5-difluorophenyl)-2-[[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 122082845 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-[[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]methyl]guanidine |
| SMILES | N/C(=N\C[C@H]1CC[C@@H](CO)O1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C13H17F2N3O2/c14-8-1-4-11(15)12(5-8)18-13(16)17-6-9-2-3-10(7-19)20-9/h1,4-5,9-10,19H,2-3,6-7H2,(H3,16,17,18)/t9-,10+/m1/s1 |
| InChIKey | YKVXKFCTVRBFHX-ZJUUUORDSA-N |
| XLogP | 1.23 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|