C14H18F2IN3 — CID 122126084
2-[(1R,2S)-2-cyclobutylcyclopropyl]-1-(2,5-difluorophenyl)guanidine;hydroiodide (PubChem CID 122126084) has the molecular formula C14H18F2IN3 and a molecular weight of 393.22 g/mol. Its IUPAC name is 2-[(1R,2S)-2-cyclobutylcyclopropyl]-1-(2,5-difluorophenyl)guanidine;hydroiodide.
| Compound Name | 2-[(1R,2S)-2-cyclobutylcyclopropyl]-1-(2,5-difluorophenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 122126084 |
| Molecular Formula | C14H18F2IN3 |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 2-[(1R,2S)-2-cyclobutylcyclopropyl]-1-(2,5-difluorophenyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\[C@@H]1C[C@H]1C1CCC1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C14H17F2N3.HI/c15-9-4-5-11(16)13(6-9)19-14(17)18-12-7-10(12)8-2-1-3-8;/h4-6,8,10,12H,1-3,7H2,(H3,17,18,19);1H/t10-,12+;/m0./s1 |
| InChIKey | JTFQKKGTJWRKKM-XOZOLZJESA-N |
| XLogP | 3.50 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|