C15H21N3 — CID 120666058
2-[(1R,2S)-2-cyclopropylcyclopropyl]-1-(4-ethylphenyl)guanidine (PubChem CID 120666058) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[(1R,2S)-2-cyclopropylcyclopropyl]-1-(4-ethylphenyl)guanidine.
| Compound Name | 2-[(1R,2S)-2-cyclopropylcyclopropyl]-1-(4-ethylphenyl)guanidine |
|---|---|
| PubChem CID | 120666058 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 2-[(1R,2S)-2-cyclopropylcyclopropyl]-1-(4-ethylphenyl)guanidine |
| SMILES | CCc1ccc(N/C(N)=N/[C@@H]2C[C@H]2C2CC2)cc1 |
| InChI | InChI=1S/C15H21N3/c1-2-10-3-7-12(8-4-10)17-15(16)18-14-9-13(14)11-5-6-11/h3-4,7-8,11,13-14H,2,5-6,9H2,1H3,(H3,16,17,18)/t13-,14+/m0/s1 |
| InChIKey | YOVFWIAXZHVOGV-UONOGXRCSA-N |
| XLogP | 2.77 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|