C19H28IN3O — CID 109394358
1-(4-ethylphenyl)-2-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide (PubChem CID 109394358) has the molecular formula C19H28IN3O and a molecular weight of 441.36 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide.
| Compound Name | 1-(4-ethylphenyl)-2-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109394358 |
| Molecular Formula | C19H28IN3O |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 1-(4-ethylphenyl)-2-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
| SMILES | CCc1ccc(N/C(N)=N/C2C3CCOC3C23CCCC3)cc1.I |
| InChI | InChI=1S/C19H27N3O.HI/c1-2-13-5-7-14(8-6-13)21-18(20)22-16-15-9-12-23-17(15)19(16)10-3-4-11-19;/h5-8,15-17H,2-4,9-12H2,1H3,(H3,20,21,22);1H |
| InChIKey | KUJTYRKXGJSVDU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|