C19H28IN3O2 — CID 109394328
1-[2-(methoxymethyl)phenyl]-2-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide (PubChem CID 109394328) has the molecular formula C19H28IN3O2 and a molecular weight of 457.36 g/mol. Its IUPAC name is 1-[2-(methoxymethyl)phenyl]-2-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide.
| Compound Name | 1-[2-(methoxymethyl)phenyl]-2-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109394328 |
| Molecular Formula | C19H28IN3O2 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 1-[2-(methoxymethyl)phenyl]-2-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
| SMILES | COCc1ccccc1N/C(N)=N/C1C2CCOC2C12CCCC2.I |
| InChI | InChI=1S/C19H27N3O2.HI/c1-23-12-13-6-2-3-7-15(13)21-18(20)22-16-14-8-11-24-17(14)19(16)9-4-5-10-19;/h2-3,6-7,14,16-17H,4-5,8-12H2,1H3,(H3,20,21,22);1H |
| InChIKey | SZDHEVKQZWXYGK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|