C16H24IN3O2 — CID 111815669
2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(2-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111815669) has the molecular formula C16H24IN3O2 and a molecular weight of 417.29 g/mol. Its IUPAC name is 2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(2-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(2-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111815669 |
| Molecular Formula | C16H24IN3O2 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(2-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccccc1N/C(N)=N/C1C2CCOC2C1(C)C.I |
| InChI | InChI=1S/C16H23N3O2.HI/c1-16(2)13(10-8-9-21-14(10)16)19-15(17)18-11-6-4-5-7-12(11)20-3;/h4-7,10,13-14H,8-9H2,1-3H3,(H3,17,18,19);1H |
| InChIKey | JPAVIBAQOCWVJP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|