C17H24ClN3O2 — CID 119148261
1-(3-chloro-4-methoxyphenyl)-2-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)guanidine (PubChem CID 119148261) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)guanidine.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)guanidine |
|---|---|
| PubChem CID | 119148261 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)guanidine |
| SMILES | COc1ccc(N/C(N)=N/C2C3CCCOC3C2(C)C)cc1Cl |
| InChI | InChI=1S/C17H24ClN3O2/c1-17(2)14(11-5-4-8-23-15(11)17)21-16(19)20-10-6-7-13(22-3)12(18)9-10/h6-7,9,11,14-15H,4-5,8H2,1-3H3,(H3,19,20,21) |
| InChIKey | ZXTLBPLCTAYCPC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|