C13H17ClIN3O — CID 122125992
1-(3-chloro-4-methoxyphenyl)-2-spiro[2.2]pentan-2-ylguanidine;hydroiodide (PubChem CID 122125992) has the molecular formula C13H17ClIN3O and a molecular weight of 393.66 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-spiro[2.2]pentan-2-ylguanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-spiro[2.2]pentan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 122125992 |
| Molecular Formula | C13H17ClIN3O |
| Molecular Weight | 393.66 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-spiro[2.2]pentan-2-ylguanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/C2CC23CC3)cc1Cl.I |
| InChI | InChI=1S/C13H16ClN3O.HI/c1-18-10-3-2-8(6-9(10)14)16-12(15)17-11-7-13(11)4-5-13;/h2-3,6,11H,4-5,7H2,1H3,(H3,15,16,17);1H |
| InChIKey | QAKXTPQNSNVREE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.66 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|