C19H27N3O — CID 109394367
1-(3,4-dimethylphenyl)-2-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine (PubChem CID 109394367) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine.
| Compound Name | 1-(3,4-dimethylphenyl)-2-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine |
|---|---|
| PubChem CID | 109394367 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine |
| SMILES | Cc1ccc(N/C(N)=N/C2C3CCOC3C23CCCC3)cc1C |
| InChI | InChI=1S/C19H27N3O/c1-12-5-6-14(11-13(12)2)21-18(20)22-16-15-7-10-23-17(15)19(16)8-3-4-9-19/h5-6,11,15-17H,3-4,7-10H2,1-2H3,(H3,20,21,22) |
| InChIKey | GXESGVOTKMMLKV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|