C17H21F3IN3O2 — CID 109378062
2-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-yl-1-[2-(trifluoromethoxy)phenyl]guanidine;hydroiodide (PubChem CID 109378062) has the molecular formula C17H21F3IN3O2 and a molecular weight of 483.27 g/mol. Its IUPAC name is 2-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-yl-1-[2-(trifluoromethoxy)phenyl]guanidine;hydroiodide.
| Compound Name | 2-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-yl-1-[2-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109378062 |
| Molecular Formula | C17H21F3IN3O2 |
| Molecular Weight | 483.27 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | 2-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-yl-1-[2-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\C1C2CCOC2C12CCC2)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C17H20F3N3O2.HI/c18-17(19,20)25-12-5-2-1-4-11(12)22-15(21)23-13-10-6-9-24-14(10)16(13)7-3-8-16;/h1-2,4-5,10,13-14H,3,6-9H2,(H3,21,22,23);1H |
| InChIKey | AGTNODZRRVLMHD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|