C14H16F3N3O — CID 120666068
2-[(1R,2S)-2-cyclopropylcyclopropyl]-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 120666068) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is 2-[(1R,2S)-2-cyclopropylcyclopropyl]-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[(1R,2S)-2-cyclopropylcyclopropyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 120666068 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[(1R,2S)-2-cyclopropylcyclopropyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | N/C(=N\[C@@H]1C[C@H]1C1CC1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16F3N3O/c15-14(16,17)21-10-5-3-9(4-6-10)19-13(18)20-12-7-11(12)8-1-2-8/h3-6,8,11-12H,1-2,7H2,(H3,18,19,20)/t11-,12+/m0/s1 |
| InChIKey | SMDDFCDMTLFUCS-NWDGAFQWSA-N |
| XLogP | 3.11 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|