C16H19F3N4O — CID 120727879
2-[(4-cyanocyclohexyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 120727879) has the molecular formula C16H19F3N4O and a molecular weight of 340.35 g/mol. Its IUPAC name is 2-[(4-cyanocyclohexyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[(4-cyanocyclohexyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 120727879 |
| Molecular Formula | C16H19F3N4O |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-[(4-cyanocyclohexyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | N#CC1CCC(C/N=C(\N)Nc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H19F3N4O/c17-16(18,19)24-14-7-5-13(6-8-14)23-15(21)22-10-12-3-1-11(9-20)2-4-12/h5-8,11-12H,1-4,10H2,(H3,21,22,23) |
| InChIKey | GTFJONINQJMIPD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 83.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|