C16H20F3IN4O — CID 120727890
2-[(4-cyanocyclohexyl)methyl]-1-[3-(trifluoromethoxy)phenyl]guanidine;hydroiodide (PubChem CID 120727890) has the molecular formula C16H20F3IN4O and a molecular weight of 468.26 g/mol. Its IUPAC name is 2-[(4-cyanocyclohexyl)methyl]-1-[3-(trifluoromethoxy)phenyl]guanidine;hydroiodide.
| Compound Name | 2-[(4-cyanocyclohexyl)methyl]-1-[3-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120727890 |
| Molecular Formula | C16H20F3IN4O |
| Molecular Weight | 468.26 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | 2-[(4-cyanocyclohexyl)methyl]-1-[3-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
| SMILES | I.N#CC1CCC(C/N=C(\N)Nc2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H19F3N4O.HI/c17-16(18,19)24-14-3-1-2-13(8-14)23-15(21)22-10-12-6-4-11(9-20)5-7-12;/h1-3,8,11-12H,4-7,10H2,(H3,21,22,23);1H |
| InChIKey | BDXXSTUMSXMRCJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 83.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.26 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|