C18H19F3N4O — CID 120580645
2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)-1-[3-(trifluoromethoxy)phenyl]guanidine (PubChem CID 120580645) has the molecular formula C18H19F3N4O and a molecular weight of 364.37 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)-1-[3-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)-1-[3-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 120580645 |
| Molecular Formula | C18H19F3N4O |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)-1-[3-(trifluoromethoxy)phenyl]guanidine |
| SMILES | N/C(=N\Cc1ccc2c(n1)CCCC2)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C18H19F3N4O/c19-18(20,21)26-15-6-3-5-13(10-15)25-17(22)23-11-14-9-8-12-4-1-2-7-16(12)24-14/h3,5-6,8-10H,1-2,4,7,11H2,(H3,22,23,25) |
| InChIKey | WEDCECXSOYNBSP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|