C19H24N4O2 — CID 120580617
1-(3,4-dimethoxyphenyl)-2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine (PubChem CID 120580617) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 120580617 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine |
| SMILES | COc1ccc(N/C(N)=N/Cc2ccc3c(n2)CCCC3)cc1OC |
| InChI | InChI=1S/C19H24N4O2/c1-24-17-10-9-14(11-18(17)25-2)23-19(20)21-12-15-8-7-13-5-3-4-6-16(13)22-15/h7-11H,3-6,12H2,1-2H3,(H3,20,21,23) |
| InChIKey | HPPJYTMGCPPEKT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|