C20H26N4O — CID 120580651
1-(4-propan-2-yloxyphenyl)-2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine (PubChem CID 120580651) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 1-(4-propan-2-yloxyphenyl)-2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine.
| Compound Name | 1-(4-propan-2-yloxyphenyl)-2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 120580651 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 1-(4-propan-2-yloxyphenyl)-2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine |
| SMILES | CC(C)Oc1ccc(N/C(N)=N/Cc2ccc3c(n2)CCCC3)cc1 |
| InChI | InChI=1S/C20H26N4O/c1-14(2)25-18-11-9-16(10-12-18)24-20(21)22-13-17-8-7-15-5-3-4-6-19(15)23-17/h7-12,14H,3-6,13H2,1-2H3,(H3,21,22,24) |
| InChIKey | NGEZIEUNKSIDTJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|