C18H23IN4O — CID 120580654
1-(4-methoxyphenyl)-2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 120580654) has the molecular formula C18H23IN4O and a molecular weight of 438.31 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(4-methoxyphenyl)-2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120580654 |
| Molecular Formula | C18H23IN4O |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2ccc3c(n2)CCCC3)cc1.I |
| InChI | InChI=1S/C18H22N4O.HI/c1-23-16-10-8-14(9-11-16)22-18(19)20-12-15-7-6-13-4-2-3-5-17(13)21-15;/h6-11H,2-5,12H2,1H3,(H3,19,20,22);1H |
| InChIKey | QKXAJXIIKPTFLP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|