C17H21IN4 — CID 120580606
1-phenyl-2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 120580606) has the molecular formula C17H21IN4 and a molecular weight of 408.29 g/mol. Its IUPAC name is 1-phenyl-2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-phenyl-2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120580606 |
| Molecular Formula | C17H21IN4 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 1-phenyl-2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc2c(n1)CCCC2)Nc1ccccc1 |
| InChI | InChI=1S/C17H20N4.HI/c18-17(21-14-7-2-1-3-8-14)19-12-15-11-10-13-6-4-5-9-16(13)20-15;/h1-3,7-8,10-11H,4-6,9,12H2,(H3,18,19,21);1H |
| InChIKey | YMDFBQJEDKYJPR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|