C11H17IN4 — CID 120580407
2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 120580407) has the molecular formula C11H17IN4 and a molecular weight of 332.19 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120580407 |
| Molecular Formula | C11H17IN4 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 2-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | I.NC(N)=NCc1ccc2c(n1)CCCC2 |
| InChI | InChI=1S/C11H16N4.HI/c12-11(13)14-7-9-6-5-8-3-1-2-4-10(8)15-9;/h5-6H,1-4,7H2,(H4,12,13,14);1H |
| InChIKey | YYWOTCDRLVWDMV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|