C10H13Cl2N — CID 138374175
2-(chloromethyl)-5,6,7,8-tetrahydroquinoline;hydrochloride (PubChem CID 138374175) has the molecular formula C10H13Cl2N and a molecular weight of 218.13 g/mol. Its IUPAC name is 2-(chloromethyl)-5,6,7,8-tetrahydroquinoline;hydrochloride.
| Compound Name | 2-(chloromethyl)-5,6,7,8-tetrahydroquinoline;hydrochloride |
|---|---|
| PubChem CID | 138374175 |
| Molecular Formula | C10H13Cl2N |
| Molecular Weight | 218.13 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 2-(chloromethyl)-5,6,7,8-tetrahydroquinoline;hydrochloride |
| SMILES | Cl.ClCc1ccc2c(n1)CCCC2 |
| InChI | InChI=1S/C10H12ClN.ClH/c11-7-9-6-5-8-3-1-2-4-10(8)12-9;/h5-6H,1-4,7H2;1H |
| InChIKey | ONLOGKYQTRVNFI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.13 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|