About N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethyl)ethanamine
N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethyl)ethanamine (PubChem CID 130164614) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethyl)ethanamine.
Molecular Properties
| Compound Name | N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethyl)ethanamine |
| PubChem CID | 130164614 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethyl)ethanamine |
| SMILES | CCNCc1ccc2c(n1)CCC2 |
| InChI | InChI=1S/C11H16N2/c1-2-12-8-10-7-6-9-4-3-5-11(9)13-10/h6-7,12H,2-5,8H2,1H3 |
| InChIKey | ZFADKFLJUZJIHQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethyl)ethanamine?
The IUPAC name of N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethyl)ethanamine (CID 130164614) is N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethyl)ethanamine.
What is the SMILES notation for N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethyl)ethanamine?
The canonical SMILES for N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethyl)ethanamine is CCNCc1ccc2c(n1)CCC2.
What is the InChIKey of N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethyl)ethanamine?
The InChIKey is ZFADKFLJUZJIHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-2-12-8-10-7-6-9-4-3-5-11(9)13-10/h6-7,12H,2-5,8H2,1H3.
What are the key properties of N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethyl)ethanamine?
N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethyl)ethanamine has a molecular weight of 176.26 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylmethyl)ethanamine is sourced from PubChem (CID 130164614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).