C12H14N2 — CID 10997754
9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole (PubChem CID 10997754) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole.
| Compound Name | 9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 10997754 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole |
| SMILES | Cn1c2c(c3ccccc31)CCNC2 |
| InChI | InChI=1S/C12H14N2/c1-14-11-5-3-2-4-9(11)10-6-7-13-8-12(10)14/h2-5,13H,6-8H2,1H3 |
| InChIKey | STMNLEHELVDDKF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|