C19H22F3IN4 — CID 120580620
1-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 120580620) has the molecular formula C19H22F3IN4 and a molecular weight of 490.31 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120580620 |
| Molecular Formula | C19H22F3IN4 |
| Molecular Weight | 490.31 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | 1-(5,6,7,8-tetrahydroquinolin-2-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc(C(F)(F)F)c1)NCc1ccc2c(n1)CCCC2 |
| InChI | InChI=1S/C19H21F3N4.HI/c20-19(21,22)15-6-3-4-13(10-15)11-24-18(23)25-12-16-9-8-14-5-1-2-7-17(14)26-16;/h3-4,6,8-10H,1-2,5,7,11-12H2,(H3,23,24,25);1H |
| InChIKey | XWVUARPJXHMGSR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|