C12H15F3IN7 — CID 120603215
1-[(2-methyltetrazol-5-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 120603215) has the molecular formula C12H15F3IN7 and a molecular weight of 441.20 g/mol. Its IUPAC name is 1-[(2-methyltetrazol-5-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-methyltetrazol-5-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120603215 |
| Molecular Formula | C12H15F3IN7 |
| Molecular Weight | 441.20 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 1-[(2-methyltetrazol-5-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | Cn1nnc(CN/C(N)=N/Cc2cccc(C(F)(F)F)c2)n1.I |
| InChI | InChI=1S/C12H14F3N7.HI/c1-22-20-10(19-21-22)7-18-11(16)17-6-8-3-2-4-9(5-8)12(13,14)15;/h2-5H,6-7H2,1H3,(H3,16,17,18);1H |
| InChIKey | DFLDGHGHFLBMFU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|