C15H18F3IN4O — CID 119140939
1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 119140939) has the molecular formula C15H18F3IN4O and a molecular weight of 454.23 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119140939 |
| Molecular Formula | C15H18F3IN4O |
| Molecular Weight | 454.23 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | Cc1noc(C)c1CN/C(N)=N/Cc1cccc(C(F)(F)F)c1.I |
| InChI | InChI=1S/C15H17F3N4O.HI/c1-9-13(10(2)23-22-9)8-21-14(19)20-7-11-4-3-5-12(6-11)15(16,17)18;/h3-6H,7-8H2,1-2H3,(H3,19,20,21);1H |
| InChIKey | HNKYBQMNCAKCIU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|