C13H18F3N3 — CID 62363272
1-tert-butyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 62363272) has the molecular formula C13H18F3N3 and a molecular weight of 273.30 g/mol. Its IUPAC name is 1-tert-butyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-tert-butyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 62363272 |
| Molecular Formula | C13H18F3N3 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-tert-butyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CC(C)(C)N/C(N)=N/Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3N3/c1-12(2,3)19-11(17)18-8-9-5-4-6-10(7-9)13(14,15)16/h4-7H,8H2,1-3H3,(H3,17,18,19) |
| InChIKey | STDMDTVCZVVYDM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|