C18H14F3N3O — CID 18751670
2-naphthalen-1-yl-1-[3-(trifluoromethoxy)phenyl]guanidine (PubChem CID 18751670) has the molecular formula C18H14F3N3O and a molecular weight of 345.32 g/mol. Its IUPAC name is 2-naphthalen-1-yl-1-[3-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-naphthalen-1-yl-1-[3-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 18751670 |
| Molecular Formula | C18H14F3N3O |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-naphthalen-1-yl-1-[3-(trifluoromethoxy)phenyl]guanidine |
| SMILES | N/C(=N\c1cccc2ccccc12)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F3N3O/c19-18(20,21)25-14-8-4-7-13(11-14)23-17(22)24-16-10-3-6-12-5-1-2-9-15(12)16/h1-11H,(H3,22,23,24) |
| InChIKey | FVLZFWRLRIFTIC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|