C19H18FN3 — CID 18751798
1-(3-ethylphenyl)-2-(7-fluoronaphthalen-1-yl)guanidine (PubChem CID 18751798) has the molecular formula C19H18FN3 and a molecular weight of 307.37 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-2-(7-fluoronaphthalen-1-yl)guanidine.
| Compound Name | 1-(3-ethylphenyl)-2-(7-fluoronaphthalen-1-yl)guanidine |
|---|---|
| PubChem CID | 18751798 |
| Molecular Formula | C19H18FN3 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-(3-ethylphenyl)-2-(7-fluoronaphthalen-1-yl)guanidine |
| SMILES | CCc1cccc(N/C(N)=N/c2cccc3ccc(F)cc23)c1 |
| InChI | InChI=1S/C19H18FN3/c1-2-13-5-3-7-16(11-13)22-19(21)23-18-8-4-6-14-9-10-15(20)12-17(14)18/h3-12H,2H2,1H3,(H3,21,22,23) |
| InChIKey | OHVWRYUVZBSIEC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|