C17H22ClN3 — CID 45265059
2-(2-ethylphenyl)-1-(3-ethylphenyl)guanidine;hydrochloride (PubChem CID 45265059) has the molecular formula C17H22ClN3 and a molecular weight of 303.84 g/mol. Its IUPAC name is 2-(2-ethylphenyl)-1-(3-ethylphenyl)guanidine;hydrochloride.
| Compound Name | 2-(2-ethylphenyl)-1-(3-ethylphenyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 45265059 |
| Molecular Formula | C17H22ClN3 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-(2-ethylphenyl)-1-(3-ethylphenyl)guanidine;hydrochloride |
| SMILES | CCc1cccc(N/C(N)=N/c2ccccc2CC)c1.Cl |
| InChI | InChI=1S/C17H21N3.ClH/c1-3-13-8-7-10-15(12-13)19-17(18)20-16-11-6-5-9-14(16)4-2;/h5-12H,3-4H2,1-2H3,(H3,18,19,20);1H |
| InChIKey | MIDRBERQSDURQI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|