C15H14F3N3 — CID 139704563
1-(3-ethylphenyl)-2-(2,4,5-trifluorophenyl)guanidine (PubChem CID 139704563) has the molecular formula C15H14F3N3 and a molecular weight of 293.29 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-2-(2,4,5-trifluorophenyl)guanidine.
| Compound Name | 1-(3-ethylphenyl)-2-(2,4,5-trifluorophenyl)guanidine |
|---|---|
| PubChem CID | 139704563 |
| Molecular Formula | C15H14F3N3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 1-(3-ethylphenyl)-2-(2,4,5-trifluorophenyl)guanidine |
| SMILES | CCc1cccc(N/C(N)=N/c2cc(F)c(F)cc2F)c1 |
| InChI | InChI=1S/C15H14F3N3/c1-2-9-4-3-5-10(6-9)20-15(19)21-14-8-12(17)11(16)7-13(14)18/h3-8H,2H2,1H3,(H3,19,20,21) |
| InChIKey | UVTYGYGSESIEAU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|